The name of the compound with the molecular formula of Al(NO2) 3 is known as aluminum nitrite. What is the name for Al OH 3? al(oh)3 acid or base.
What is the compound name for Rb2CrO4?
Rubidium Chromate | Chromic acid, dirubidium salt | Rb2CrO4 – Ereztech.
What is the formula of Aluminium nitrite?
Aluminum nitrite | AlN3O6 – PubChem.
What is the correct Iupac name for alpo4?
| PubChem CID | 64655 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | AlPO4 or AlO4P |
| Synonyms | Aluminum phosphate 7784-30-7 Aluminum monophosphate Monoaluminum phosphate UNII-F92V3S521O More… |
What is the correct Iupac name for li3po4?
| PubChem CID | 165867 |
|---|---|
| Molecular Formula | Li3O4P |
| Synonyms | Lithium phosphate 10377-52-3 Phosphoric acid, trilithium salt Lithium orthophosphate trilithium;phosphate More… |
| Molecular Weight | 115.9 |
| Component Compounds | CID 1004 (Phosphoric acid) CID 1061 (Phosphate) CID 3028194 (Lithium) |
What is the correct name for Al?
| Element Name | Aluminum |
|---|---|
| Element Symbol | Al |
| Atomic Number | 13 |
What is NO3 chemical name?
Nitrate is a polyatomic ion with the chemical formula NO−3. Salts containing this ion are called nitrates. Nitrates are common components of fertilizers and explosives.
What is the name for the polyatomic ion po4 3?
| Symbols and Names of Some Common Polyatomic Ions and One Molecule | ||
|---|---|---|
| NH4+ | ammonium ion | hydroxide ion |
| PO43- | phosphate ion | hypochlorite ion |
| HPO42- | hydrogen phosphate | chromate ion |
| H2PO4- | dihydrogen phosphate | dichromate ion |
What is the name of the compound with the formula pi3?
| PubChem CID | 83485 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | PI3 or I3P |
| Synonyms | Phosphorus triiodide 13455-01-1 Phosphorous triiodide Phosphorus(III) iodide triiodophosphane More… |
| Molecular Weight | 411.6872 |
What is the proper name for CuCl quizlet?
In this case, the compound could either be Copper (I) Chloride, or CuCl, or it could be Copper (II) Chloride, which is CuCl2.
What is Al NO2?
Aluminum Nitrite. Aluminum Nitrite. Formula: Al(NO2)3.
What is the name for al NO2 2?
Explanation: Aluminum nitrite consists of the aluminum cation Al3+ and the polyatomic nitrite anion NO−2 .
What is the chemical formula for Al and N?
| Names | |
|---|---|
| show SMILES | |
| Properties | |
| Chemical formula | AlN |
| Molar mass | 40.989 g/mol |
What is the correct name for Co2 CO3 3?
The chemical name of Co2(CO3)3 is: Cobalt carbonate Cobalt (III) carbonate Cobalt (Il) carbonate Cobalt (III) carbonate (II)
Is AlPO4 binary or ternary?
| A | B |
|---|---|
| Aluminum Chlorate | Al(ClO3)3 |
| Aluminum Carbonate | Al2(CO3)3 |
| Aluminum Sulfate | Al2(SO4)3 |
| Aluminum Phosphate | AlPO4 |
What is the correct Iupac name for al io3 3?
| Linear Formula | Al(IO3)3 |
|---|---|
| Pubchem CID | 129657299 |
| IUPAC Name | diiodyloxyalumanyl iodate |
| SMILES | O=I(=O)O[Al](OI(=O)=O)OI(=O)=O |
| InchI Identifier | InChI=1S/Al.3HIO3/c;3*2-1(3)4/h;3*(H,2,3,4)/q+3;;;/p-3 |
What is the name of PB OH 3?
NamesIUPAC name Lead(II) hydroxideOther names lead hydroxide plumbous hydroxideIdentifiersCAS Number19783-14-3
What is nitrate and nitrite?
Nitrates and nitrites are two different types of compound. Nitrates (NO3) consist of one nitrogen atom and three oxygen atoms. Nitrites (NO2) consist of one nitrogen atom and two oxygen atoms. Nitrates are relatively inert, which means they’re stable and unlikely to change and cause harm.
What does the 3 in NO3 mean?
nitrate group. trioxonitrate(V) trioxonitrate(1-) trioxidonitrate(1-) Nitrates, inorganic, n.o.s.
How do you name nh4no2?
Ammonium nitrite, NH4NO2, is the ammonium salt of nitrous acid.
What is the name of the compound with the formula NH4NO3 fill in the blank 3?
ammonium nitrate, (NH4NO3), a salt of ammonia and nitric acid, used widely in fertilizers and explosives. The commercial grade contains about 33.5 percent nitrogen, all of which is in forms utilizable by plants; it is the most common nitrogenous component of artificial fertilizers.
Is no2 polyatomic?
FormulaNameNO2-NitriteCH3CO2-AcetateCN-CyanideMnO4-Permanganate
How does po4 have a 3 charge?
Step1: Calculate the total number of valence electrons available. Let’s use PO43- as our example. … For each negative charge on an ion, we need to add 1 valence electron so this makes the total 29 + 3 = 32 valence electrons. This means we have 32 electrons to distribute into bonds to create phosphate ion.
What bond type is PI3?
PI3 covalent bonds | Science, Chemistry, Molecules, Atoms, Elements, Periodic Table | ShowMe.
What is the gram formula mass for PI3?
NamesChemical formulaPI3Molar mass411.68717 g/molAppearancedark red solidDensity4.18 g/cm3
What is the name of the compound with the formula no2?
PubChem CID3032552StructureFind Similar StructuresChemical SafetyLaboratory Chemical Safety Summary (LCSS) DatasheetMolecular FormulaNO2Synonyms10102-44-0 Nitrogen dioxide Nitrogen dioxide, >=99.5% DTXSID7020974
What is the proper name for mgf2?
NamesChemical formulaMgF2Molar mass62.3018 g/molAppearanceWhite tetragonal crystalsDensity3.148 g/cm3
What is the molar mass of Al NO3 3?
Formula of the compound is Al(NO3)3. There are many different physical properties of this compound. For example, aluminum nitrate has molar mass which is equal to 212.996 g/mol. As for the density of the compound, it is 1.401 g/cm3.
How many atoms are in Al NO2 3?
9 atoms of oxygen, 3 nitrogen atoms, and 1 aluminum atom.