| IUPAC Name | |
|---|---|
| Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
| Molecular Formula | P4S3 |
| Molar Mass | 220.075 g/mol |
| InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
What is the name for this compound P4S3?
Phosphorus sulfide (P4S3) Phosphorus(III) sulfide(IV)
What is C3N4 chemistry?
Carbon Nitride Solid (C3N4)
What is the present by weight of P in the compound in P4S3?
| Element | Symbol | Mass Percent |
|---|---|---|
| Phosphorus | P | 56.293% |
| Sulfur | S | 43.707% |
What is SO3 compound name?
| Code | SO3 |
|---|---|
| One-letter code | X |
| Molecule name | SULFITE ION |
| Systematic names | Program Version Name ACDLabs 10.04 sulfite OpenEye OEToolkits 1.5.0 sulfite |
| Formula | O3 S |
What is the name of S2Cl6?
Hexasulfur Dichloride S2Cl6 Molecular Weight — EndMemo.
What is the formula of carbon nitride?
| Compound Formula | C3N4+xHy |
|---|---|
| Density | 2.336 g/cm3 |
| Average Particle Size | > 30 microns |
| Specific Surface Area | >35 m2/g |
| Solubility in H2O | N/A |
What is acetate formula?
Acetate | C2H3O2– – PubChem.
What type of compound is lithium acetate?
An acetate salt comprising equal numbers of acetate and lithium ions. Lithium acetate (CH3COOLi) is a salt of lithium and acetic acid.
What is the name of the compound nh4br?
| ChEBI Name | ammonium bromide |
|---|---|
| Definition | An ammonium salt composed of ammonium and bromide ions in a 1:1 ratio. |
What is the name of the compound p4 s3?
| IUPAC Name | |
|---|---|
| Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
| Molecular Formula | P4S3 |
| Molar Mass | 220.075 g/mol |
| InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
What is the name of the compound with the formula SO3 quizlet?
What is the name for the compound with the formula SO3? The name for SO3 is sulfur trioxide.
What is the name of the compound whose formula is Na2O?
| PubChem CID | 73971 |
|---|---|
| Molecular Formula | Na2O |
| Synonyms | Sodium oxide 1313-59-3 disodium;oxygen(2-) Sodium oxide (Na2O) UNII-3075U8R23D More… |
| Molecular Weight | 61.979 |
| Component Compounds | CID 190217 (Oxide) CID 5360545 (Sodium) |
What is the correct name for PH3 3 points?
Phosphine (IUPAC name: phosphane) is a colourless, flammable, very toxic gas compound with the chemical formula PH3, classed as a pnictogen hydride.
What is the formula for Diselenium hexafluoride?
Selenium hexafluoride | SeF6 – PubChem.
What is the ionic formula between strontium and nitrite?
Strontium nitrite(Sr(NO2)2)
How do you make carbon nitride?
Generally, carbon nitride materials are prepared by the calcination method. The starting material containing carbon and nitrogen is heated around 600°C for ~ 5 h. During this process, the bulk carbon nitride forms by self-condensation. The obtained bulk material is used in the next step of exfoliation.
What is the formula for hydroxide?
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Hydroxide is a diatomic anion with chemical formula OH−. It consists of an oxygen and hydrogen atom held together by a single covalent bond, and carries a negative electric charge.
Why is Acetate named Acetate?
Acetic Acid and Acetates When the negatively-charged acetate anion combines with a positively charged cation, the resulting compound is called an acetate.
Is Lithium chloride a binary compound?
ABlithium nitrideLi3Nlithium phosphideLi3Pberyllium fluorideBeF2beryllium chlorideBeCl2
Which chemical names are ionic compounds?
For binary ionic compounds (ionic compounds that contain only two types of elements), the compounds are named by writing the name of the cation first followed by the name of the anion. For example, KCl, an ionic compound that contains K+ and Cl- ions, is named potassium chloride.
